CAS 2287249-17-4 is the registry number for (3R,5R)-4,4-Difluoro-3,5-dimethylpiperidine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,5R)-4,4-difluoro-3,5-dimethylpiperidine;hydrochloride (CAS 2287249-17-4) is a chemical compound with the molecular formula C7H14ClF2N and a molecular weight of 185.64 g/mol. IUPAC name: (3R,5R)-4,4-difluoro-3,5-dimethylpiperidine;hydrochloride. InChIKey: GTJWXINJWOFKPF-KGZKBUQUSA-N.
| Molecular formula | C7H14ClF2N |
|---|---|
| Molecular weight | 185.64 g/mol |
| IUPAC name | (3R,5R)-4,4-difluoro-3,5-dimethylpiperidine;hydrochloride |
| InChIKey | GTJWXINJWOFKPF-KGZKBUQUSA-N |
| SMILES | C[C@@H]1CNC[C@H](C1(F)F)C.Cl |
Computed by PubChem (NCBI)