Products 1257326-23-0
CAS 1257326-23-0 appears in our catalog under these names: NPEC-caged-dopamine, NPEC–caged–dopamine, NPEC-caged-dopamine, 99.94%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 100mg, 10mg, 25mg, 5mg, 10 mg, 5 mg, 25 mg, 100 mg.
1-(2-nitrophenyl)ethyl N-[2-(3,4-dihydroxyphenyl)ethyl]carbamate (CAS 1257326-23-0) is a chemical compound with the molecular formula C17H18N2O6 and a molecular weight of 346.3 g/mol. IUPAC name: 1-(2-nitrophenyl)ethyl N-[2-(3,4-dihydroxyphenyl)ethyl]carbamate. InChIKey: PDNNZLULXSQJGZ-UHFFFAOYSA-N.
| Molecular formula | C17H18N2O6 |
|---|---|
| Molecular weight | 346.3 g/mol |
| IUPAC name | 1-(2-nitrophenyl)ethyl N-[2-(3,4-dihydroxyphenyl)ethyl]carbamate |
| InChIKey | PDNNZLULXSQJGZ-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1[N+](=O)[O-])OC(=O)NCCC2=CC(=C(C=C2)O)O |
Computed by PubChem (NCBI)