CAS 1257442-93-5 appears in our catalog under these names: Endo-8-azabicyclo[3.2.1]octane-3-methanol hydrochloride, 95%, (1R,3r,5S)-8-Azabicyclo[3.2.1]octan-3-ylmethanol hydrochloride, 97%, 97%, (1R,3r,5S)-8-Azabicyclo[3.2.1]octan-3-ylmethanol hydrochloride, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg, 500mg.
[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]methanol;hydrochloride (CAS 1257442-93-5) is a chemical compound with the molecular formula C8H16ClNO and a molecular weight of 177.67 g/mol. IUPAC name: [(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]methanol;hydrochloride. InChIKey: KBDRFDLINZOCBD-OPZYXJLOSA-N.
| Molecular formula | C8H16ClNO |
|---|---|
| Molecular weight | 177.67 g/mol |
| IUPAC name | [(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]methanol;hydrochloride |
| InChIKey | KBDRFDLINZOCBD-OPZYXJLOSA-N |
| SMILES | C1C[C@H]2CC(C[C@@H]1N2)CO.Cl |
Computed by PubChem (NCBI)