CAS 1389264-20-3 appears in our catalog under these names: exo-8-Azabicyclo(3.2.1)octane-3-methanol HCl, exo-8-Azabicyclo(3.2.1)octan-3-ylmethanol hydrochloride, 97%, exo-8-Azabicyclo[3.2.1]octan-3-ylmethanol hydrochloride, 97%, 97%. Offered by: Biosynth, AmBeed, Chemat. Available pack sizes: 5g, 0,5g, 10g, 100mg, 250mg, 500mg, 1g.
[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]methanol;hydrochloride (CAS 1389264-20-3) is a chemical compound with the molecular formula C8H16ClNO and a molecular weight of 177.67 g/mol. IUPAC name: [(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]methanol;hydrochloride. InChIKey: KBDRFDLINZOCBD-OPZYXJLOSA-N.
| Molecular formula | C8H16ClNO |
|---|---|
| Molecular weight | 177.67 g/mol |
| IUPAC name | [(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]methanol;hydrochloride |
| InChIKey | KBDRFDLINZOCBD-OPZYXJLOSA-N |
| SMILES | C1C[C@H]2CC(C[C@@H]1N2)CO.Cl |
Computed by PubChem (NCBI)