CAS 1257535-39-9 appears in our catalog under these names: 3-Amino-4-azaindole dihydrochloride, 95%, 1H-Pyrrolo(3,2-b)pyridin-3-amine dihydrochloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 100mg, 1g.
1H-pyrrolo[3,2-b]pyridin-3-amine;dihydrochloride (CAS 1257535-39-9) is a chemical compound with the molecular formula C7H9Cl2N3 and a molecular weight of 206.07 g/mol. IUPAC name: 1H-pyrrolo[3,2-b]pyridin-3-amine;dihydrochloride. InChIKey: HYXDRMBOOYKXJR-UHFFFAOYSA-N.
| Molecular formula | C7H9Cl2N3 |
|---|---|
| Molecular weight | 206.07 g/mol |
| IUPAC name | 1H-pyrrolo[3,2-b]pyridin-3-amine;dihydrochloride |
| InChIKey | HYXDRMBOOYKXJR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=CN2)N)N=C1.Cl.Cl |
Computed by PubChem (NCBI)