CAS 24067-11-6 appears in our catalog under these names: N-(2-Chloro-phenyl)-guanidine hydrochloride, 96%, N–(2–Chloro–phenyl)–guanidine hydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 250mg, 5g, 100mg.
2-(2-chlorophenyl)guanidine;hydrochloride (CAS 24067-11-6) is a chemical compound with the molecular formula C7H9Cl2N3 and a molecular weight of 206.07 g/mol. IUPAC name: 2-(2-chlorophenyl)guanidine;hydrochloride. InChIKey: IMUSEVRDOXRQIE-UHFFFAOYSA-N.
| Molecular formula | C7H9Cl2N3 |
|---|---|
| Molecular weight | 206.07 g/mol |
| IUPAC name | 2-(2-chlorophenyl)guanidine;hydrochloride |
| InChIKey | IMUSEVRDOXRQIE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N=C(N)N)Cl.Cl |
Computed by PubChem (NCBI)