CAS 1263378-17-1 is the registry number for Imidazo[1,2-a]pyridin-2-amine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
Imidazo[1,2-a]pyridin-2-amine;dihydrochloride (CAS 1263378-17-1) is a chemical compound with the molecular formula C7H9Cl2N3 and a molecular weight of 206.07 g/mol. IUPAC name: imidazo[1,2-a]pyridin-2-amine;dihydrochloride. InChIKey: GIEWYRPIJDREMT-UHFFFAOYSA-N.
| Molecular formula | C7H9Cl2N3 |
|---|---|
| Molecular weight | 206.07 g/mol |
| IUPAC name | imidazo[1,2-a]pyridin-2-amine;dihydrochloride |
| InChIKey | GIEWYRPIJDREMT-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CN2C=C1)N.Cl.Cl |
Computed by PubChem (NCBI)