CAS 1257553-09-5 appears in our catalog under these names: 5-(4-(Methylsulfonyl)benzyl)-1,3,4-oxadiazol-2-amine, 95%, 5-((4-Methanesulfonylphenyl)methyl)-1,3,4-oxadiazol-2-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 250mg, 1g, 0,5g, 50mg.
5-[(4-methylsulfonylphenyl)methyl]-1,3,4-oxadiazol-2-amine (CAS 1257553-09-5) is a chemical compound with the molecular formula C10H11N3O3S and a molecular weight of 253.28 g/mol. IUPAC name: 5-[(4-methylsulfonylphenyl)methyl]-1,3,4-oxadiazol-2-amine. InChIKey: FMGPBEYBLVZGNQ-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O3S |
|---|---|
| Molecular weight | 253.28 g/mol |
| IUPAC name | 5-[(4-methylsulfonylphenyl)methyl]-1,3,4-oxadiazol-2-amine |
| InChIKey | FMGPBEYBLVZGNQ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)CC2=NN=C(O2)N |
Computed by PubChem (NCBI)