Products 23646-86-8

CAS 23646-86-8 is the registry number for 3-(5-Amino-3-methyl-1H-pyrazol-1-yl)benzenesulfonic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(5-amino-3-methylpyrazol-1-yl)benzenesulfonic acid (CAS 23646-86-8) is a chemical compound with the molecular formula C10H11N3O3S and a molecular weight of 253.28 g/mol. IUPAC name: 3-(5-amino-3-methylpyrazol-1-yl)benzenesulfonic acid. InChIKey: MVUDWRDRXUICGJ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11N3O3S
Molecular weight253.28 g/mol
IUPAC name3-(5-amino-3-methylpyrazol-1-yl)benzenesulfonic acid
InChIKeyMVUDWRDRXUICGJ-UHFFFAOYSA-N
SMILESCC1=NN(C(=C1)N)C2=CC(=CC=C2)S(=O)(=O)O

Computed by PubChem (NCBI)