CAS 5098-14-6 appears in our catalog under these names: Aminomalononitrile p-Toluenesulfonate, Aminomalononitrile p–Toluenesulfonate, Aminomalononitrile p-Toluenesulfonate, >98.0%(T), 2-Aminomalononitrile 4-methylbenzenesulfonate 95% (contains <6.5%H2O), AMINOMALONONITRILE P-TOLUENESULFONATE, &. Offered by: TRC, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 10g, 1g, 5g, 100g, 25g, 500g, 50g, 250mg.
2-aminopropanedinitrile;4-methylbenzenesulfonic acid (CAS 5098-14-6) is a chemical compound with the molecular formula C10H11N3O3S and a molecular weight of 253.28 g/mol. IUPAC name: 2-aminopropanedinitrile;4-methylbenzenesulfonic acid. InChIKey: MEUWQVWJLLBVQI-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O3S |
|---|---|
| Molecular weight | 253.28 g/mol |
| IUPAC name | 2-aminopropanedinitrile;4-methylbenzenesulfonic acid |
| InChIKey | MEUWQVWJLLBVQI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C(#N)C(C#N)N |
Computed by PubChem (NCBI)