CAS 1257641-06-7 appears in our catalog under these names: 4–Fluorophenylboronic acid MIDA ester, 2-(4-Fluorophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione, 98%, 98%, 2-(4-fluorophenyl)-6-methyl-2,6-dihydro-1,3,6,2-dioxazaborocine-4,8-diol, 98%, 2-(4-Fluorophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 100g, 25g.
2-(4-fluorophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione (CAS 1257641-06-7) is a chemical compound with the molecular formula C11H11BFNO4 and a molecular weight of 251.02 g/mol. IUPAC name: 2-(4-fluorophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione. InChIKey: VRWBUFHGNOFGKX-UHFFFAOYSA-N.
| Molecular formula | C11H11BFNO4 |
|---|---|
| Molecular weight | 251.02 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione |
| InChIKey | VRWBUFHGNOFGKX-UHFFFAOYSA-N |
| SMILES | B1(OC(=O)CN(CC(=O)O1)C)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)