Products 1311484-55-5

CAS 1311484-55-5 is the registry number for 3-Fluorophenylboronic acid mida ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

2-(3-fluorophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione (CAS 1311484-55-5) is a chemical compound with the molecular formula C11H11BFNO4 and a molecular weight of 251.02 g/mol. IUPAC name: 2-(3-fluorophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione. InChIKey: BEIIVLQOKBPWDE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11BFNO4
Molecular weight251.02 g/mol
IUPAC name2-(3-fluorophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione
InChIKeyBEIIVLQOKBPWDE-UHFFFAOYSA-N
SMILESB1(OC(=O)CN(CC(=O)O1)C)C2=CC(=CC=C2)F

Computed by PubChem (NCBI)