CAS 1360806-61-6 is the registry number for 2-(4-Fluorophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.
2-(4-fluorophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione (CAS 1360806-61-6) is a chemical compound with the molecular formula C11H11BFNO4 and a molecular weight of 251.02 g/mol. IUPAC name: 2-(4-fluorophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione. InChIKey: VRWBUFHGNOFGKX-UHFFFAOYSA-N.
| Molecular formula | C11H11BFNO4 |
|---|---|
| Molecular weight | 251.02 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione |
| InChIKey | VRWBUFHGNOFGKX-UHFFFAOYSA-N |
| SMILES | B1(OC(=O)CN(CC(=O)O1)C)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)