CAS 1257649-56-1 is the registry number for 4-Iodophenylboronic acid MIDA ester, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-(4-iodophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione (CAS 1257649-56-1) is a chemical compound with the molecular formula C11H11BINO4 and a molecular weight of 358.93 g/mol. IUPAC name: 2-(4-iodophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione. InChIKey: KIKNJEGAWBNFLW-UHFFFAOYSA-N.
| Molecular formula | C11H11BINO4 |
|---|---|
| Molecular weight | 358.93 g/mol |
| IUPAC name | 2-(4-iodophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione |
| InChIKey | KIKNJEGAWBNFLW-UHFFFAOYSA-N |
| SMILES | B1(OC(=O)CN(CC(=O)O1)C)C2=CC=C(C=C2)I |
Computed by PubChem (NCBI)