Products 1257649-56-1

CAS 1257649-56-1 is the registry number for 4-Iodophenylboronic acid MIDA ester, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

2-(4-iodophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione (CAS 1257649-56-1) is a chemical compound with the molecular formula C11H11BINO4 and a molecular weight of 358.93 g/mol. IUPAC name: 2-(4-iodophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione. InChIKey: KIKNJEGAWBNFLW-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11BINO4
Molecular weight358.93 g/mol
IUPAC name2-(4-iodophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione
InChIKeyKIKNJEGAWBNFLW-UHFFFAOYSA-N
SMILESB1(OC(=O)CN(CC(=O)O1)C)C2=CC=C(C=C2)I

Computed by PubChem (NCBI)