CAS 1287221-36-6 appears in our catalog under these names: 2-(4-Iodophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione, 97%, 4-Iodophenylboronic acid MIDA ester 98%, (T-4)-[N-[(Carboxy-κO)methyl]-N-methylglycinato(2-)-κN,κO](4-iodophenyl)boron, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 100g, 10g, 25g.
2-(4-iodophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione (CAS 1287221-36-6) is a chemical compound with the molecular formula C11H11BINO4 and a molecular weight of 358.93 g/mol. IUPAC name: 2-(4-iodophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione. InChIKey: KIKNJEGAWBNFLW-UHFFFAOYSA-N.
| Molecular formula | C11H11BINO4 |
|---|---|
| Molecular weight | 358.93 g/mol |
| IUPAC name | 2-(4-iodophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione |
| InChIKey | KIKNJEGAWBNFLW-UHFFFAOYSA-N |
| SMILES | B1(OC(=O)CN(CC(=O)O1)C)C2=CC=C(C=C2)I |
Computed by PubChem (NCBI)