CAS 1287221-37-7 is the registry number for 2-(3-Iodophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione, 97%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
2-(3-iodophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione (CAS 1287221-37-7) is a chemical compound with the molecular formula C11H11BINO4 and a molecular weight of 358.93 g/mol. IUPAC name: 2-(3-iodophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione. InChIKey: GEXCTPQCJMYLNP-UHFFFAOYSA-N.
| Molecular formula | C11H11BINO4 |
|---|---|
| Molecular weight | 358.93 g/mol |
| IUPAC name | 2-(3-iodophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione |
| InChIKey | GEXCTPQCJMYLNP-UHFFFAOYSA-N |
| SMILES | B1(OC(=O)CN(CC(=O)O1)C)C2=CC(=CC=C2)I |
Computed by PubChem (NCBI)