Products 125770-94-7
CAS 125770-94-7 appears in our catalog under these names: Acetophenone-13C6, >95% (GC), Acetophenone–13C6, Acetophenone-13C6, Acetophenone-13C6, 98.42%. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 1mg, 5mg, 100mg, 5 mg, 1 mg.
1-((1,2,3,4,5,6-13C6)cyclohexatrienyl)ethanone (CAS 125770-94-7) is a chemical compound with the molecular formula C8H8O and a molecular weight of 126.10 g/mol. IUPAC name: 1-((1,2,3,4,5,6-13C6)cyclohexatrienyl)ethanone. InChIKey: KWOLFJPFCHCOCG-OLGKHRKTSA-N.
| Molecular formula | C8H8O |
|---|---|
| Molecular weight | 126.10 g/mol |
| IUPAC name | 1-((1,2,3,4,5,6-13C6)cyclohexatrienyl)ethanone |
| InChIKey | KWOLFJPFCHCOCG-OLGKHRKTSA-N |
| SMILES | CC(=O)[13C]1=[13CH][13CH]=[13CH][13CH]=[13CH]1 |
Computed by PubChem (NCBI)