CAS 17537-31-4 appears in our catalog under these names: Acetophenone-d3, Aceto-d3-phenone, 99 atom % D, min 98% Chemical Purity, Acetophenone–d3, ACETOPHENONE-METHYL-D3, 98 ATOM % D, Acetophenone-d3, 98.0%. Offered by: TRC, CDN, GLPBio, Sigma-Aldrich, MedChemExpress. Available pack sizes: 100mg, 1g, 500mg, 5g, 10g, 1 g, 5 g, 10 g.
2,2,2-trideuterio-1-phenylethanone (CAS 17537-31-4) is a chemical compound with the molecular formula C8H8O and a molecular weight of 123.17 g/mol. IUPAC name: 2,2,2-trideuterio-1-phenylethanone. InChIKey: KWOLFJPFCHCOCG-FIBGUPNXSA-N.
| Molecular formula | C8H8O |
|---|---|
| Molecular weight | 123.17 g/mol |
| IUPAC name | 2,2,2-trideuterio-1-phenylethanone |
| InChIKey | KWOLFJPFCHCOCG-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)