CAS 190314-15-9 appears in our catalog under these names: Acetophenone-1,2-13C2, 98% +98%atom%13C, ACETOPHENONE-ALPHA,BETA-13C2, 99 ATOM% &, ACETOPHENONE-1,2-13C2, Acetophenone-13C2. Offered by: Chemat Brand, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: on request, 250MG, 1mg, 5mg.
1-phenyl(1,2-13C2)ethanone (CAS 190314-15-9) is a chemical compound with the molecular formula C8H8O and a molecular weight of 122.13 g/mol. IUPAC name: 1-phenyl(1,2-13C2)ethanone. InChIKey: KWOLFJPFCHCOCG-SPBYTNOZSA-N.
| Molecular formula | C8H8O |
|---|---|
| Molecular weight | 122.13 g/mol |
| IUPAC name | 1-phenyl(1,2-13C2)ethanone |
| InChIKey | KWOLFJPFCHCOCG-SPBYTNOZSA-N |
| SMILES | [13CH3][13C](=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)