Products 1258640-38-8
CAS 1258640-38-8 appears in our catalog under these names: 4-Methoxy-5-(methylsulfanyl)-2-nitrobenzoic acid, 95%, 4-Methoxy-5-(methylsulfanyl)-2-nitrobenzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
4-methoxy-5-methylsulfanyl-2-nitrobenzoic acid (CAS 1258640-38-8) is a chemical compound with the molecular formula C9H9NO5S and a molecular weight of 243.24 g/mol. IUPAC name: 4-methoxy-5-methylsulfanyl-2-nitrobenzoic acid. InChIKey: GTAANEOXZIUSGB-UHFFFAOYSA-N.
| Molecular formula | C9H9NO5S |
|---|---|
| Molecular weight | 243.24 g/mol |
| IUPAC name | 4-methoxy-5-methylsulfanyl-2-nitrobenzoic acid |
| InChIKey | GTAANEOXZIUSGB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)[N+](=O)[O-])C(=O)O)SC |
Computed by PubChem (NCBI)