CAS 60987-22-6 appears in our catalog under these names: 5,6-Dimethoxy-2,3-dihydro-1,2-benzothiazole-1,1,3-trione, 95%, 5,6-Dimethoxy-2,3-dihydro-1,2-benzothiazole-1,1,3-trione. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
5,6-dimethoxy-1,1-dioxo-1,2-benzothiazol-3-one (CAS 60987-22-6) is a chemical compound with the molecular formula C9H9NO5S and a molecular weight of 243.24 g/mol. IUPAC name: 5,6-dimethoxy-1,1-dioxo-1,2-benzothiazol-3-one. InChIKey: SUIQIOALWGAJCD-UHFFFAOYSA-N.
| Molecular formula | C9H9NO5S |
|---|---|
| Molecular weight | 243.24 g/mol |
| IUPAC name | 5,6-dimethoxy-1,1-dioxo-1,2-benzothiazol-3-one |
| InChIKey | SUIQIOALWGAJCD-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=O)NS2(=O)=O)OC |
Computed by PubChem (NCBI)