CAS 5031-74-3 is the registry number for 6-[(2-Hydroxyethyl)sulfonyl]benzoxazol-2-(3h)one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.
6-(2-hydroxyethylsulfonyl)-3H-1,3-benzoxazol-2-one (CAS 5031-74-3) is a chemical compound with the molecular formula C9H9NO5S and a molecular weight of 243.24 g/mol. IUPAC name: 6-(2-hydroxyethylsulfonyl)-3H-1,3-benzoxazol-2-one. InChIKey: NLKFSULXKPSHMS-UHFFFAOYSA-N.
| Molecular formula | C9H9NO5S |
|---|---|
| Molecular weight | 243.24 g/mol |
| IUPAC name | 6-(2-hydroxyethylsulfonyl)-3H-1,3-benzoxazol-2-one |
| InChIKey | NLKFSULXKPSHMS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1S(=O)(=O)CCO)OC(=O)N2 |
Computed by PubChem (NCBI)