CAS 1258640-50-4 is the registry number for (3-(4-Fluorophenyl)-1H-1,2,4-triazol-5-yl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
[3-(4-fluorophenyl)-1H-1,2,4-triazol-5-yl]methanamine;hydrochloride (CAS 1258640-50-4) is a chemical compound with the molecular formula C9H10ClFN4 and a molecular weight of 228.65 g/mol. IUPAC name: [3-(4-fluorophenyl)-1H-1,2,4-triazol-5-yl]methanamine;hydrochloride. InChIKey: HWMYFTYUGFWJJO-UHFFFAOYSA-N.
| Molecular formula | C9H10ClFN4 |
|---|---|
| Molecular weight | 228.65 g/mol |
| IUPAC name | [3-(4-fluorophenyl)-1H-1,2,4-triazol-5-yl]methanamine;hydrochloride |
| InChIKey | HWMYFTYUGFWJJO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NNC(=N2)CN)F.Cl |
Computed by PubChem (NCBI)