CAS 1788627-28-0 appears in our catalog under these names: 1-(3-Fluoro-5-methylphenyl)-1H-1,2,3-triazol-4-amine hydrochloride, 95%, 1-(3-Fluoro-5-methylphenyl)-1H-1,2,3-triazol-4-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(3-fluoro-5-methylphenyl)triazol-4-amine;hydrochloride (CAS 1788627-28-0) is a chemical compound with the molecular formula C9H10ClFN4 and a molecular weight of 228.65 g/mol. IUPAC name: 1-(3-fluoro-5-methylphenyl)triazol-4-amine;hydrochloride. InChIKey: NZQVILLKPDQQLX-UHFFFAOYSA-N.
| Molecular formula | C9H10ClFN4 |
|---|---|
| Molecular weight | 228.65 g/mol |
| IUPAC name | 1-(3-fluoro-5-methylphenyl)triazol-4-amine;hydrochloride |
| InChIKey | NZQVILLKPDQQLX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)F)N2C=C(N=N2)N.Cl |
Computed by PubChem (NCBI)