CAS 1955499-10-1 is the registry number for 1-(4-Fluorophenyl)-5-methyl-1H-1,2,3-triazol-4-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(4-fluorophenyl)-5-methyltriazol-4-amine;hydrochloride (CAS 1955499-10-1) is a chemical compound with the molecular formula C9H10ClFN4 and a molecular weight of 228.65 g/mol. IUPAC name: 1-(4-fluorophenyl)-5-methyltriazol-4-amine;hydrochloride. InChIKey: XCFGJUIIFPPPPW-UHFFFAOYSA-N.
| Molecular formula | C9H10ClFN4 |
|---|---|
| Molecular weight | 228.65 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-5-methyltriazol-4-amine;hydrochloride |
| InChIKey | XCFGJUIIFPPPPW-UHFFFAOYSA-N |
| SMILES | CC1=C(N=NN1C2=CC=C(C=C2)F)N.Cl |
Computed by PubChem (NCBI)