CAS 1258640-83-3 is the registry number for rel-(1R,2S)-2-(Trifluoromethyl)cyclopropanamine hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.
Cis-(1R,2S)-2-(trifluoromethyl)cyclopropan-1-amine;hydrochloride (CAS 1258640-83-3) is a chemical compound with the molecular formula C4H7ClF3N and a molecular weight of 161.55 g/mol. IUPAC name: cis-(1R,2S)-2-(trifluoromethyl)cyclopropan-1-amine;hydrochloride. InChIKey: SOHXDJVKUXKZIJ-LJUKVTEVSA-N.
| Molecular formula | C4H7ClF3N |
|---|---|
| Molecular weight | 161.55 g/mol |
| IUPAC name | cis-(1R,2S)-2-(trifluoromethyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | SOHXDJVKUXKZIJ-LJUKVTEVSA-N |
| SMILES | C1[C@@H]([C@@H]1N)C(F)(F)F.Cl |
Computed by PubChem (NCBI)