CAS 1820569-86-5 is the registry number for (1R,2R)-2-(Trifluoromethyl)cyclopropanamine hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Trans-(1R,2R)-2-(trifluoromethyl)cyclopropan-1-amine;hydrochloride (CAS 1820569-86-5) is a chemical compound with the molecular formula C4H7ClF3N and a molecular weight of 161.55 g/mol. IUPAC name: trans-(1R,2R)-2-(trifluoromethyl)cyclopropan-1-amine;hydrochloride. InChIKey: SOHXDJVKUXKZIJ-SWLXLVAMSA-N.
| Molecular formula | C4H7ClF3N |
|---|---|
| Molecular weight | 161.55 g/mol |
| IUPAC name | trans-(1R,2R)-2-(trifluoromethyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | SOHXDJVKUXKZIJ-SWLXLVAMSA-N |
| SMILES | C1[C@H]([C@@H]1N)C(F)(F)F.Cl |
Computed by PubChem (NCBI)