CAS 1287760-01-3 appears in our catalog under these names: Trans-2-(trifluoromethyl)cyclopropanamine hydrochloride, 95%, trans-2-(Trifluoromethyl)cyclopropylamine hydrochloride, 95+%, rac-(1R,2R)-2-(Trifluoromethyl)cyclopropan-1-amine hydrochloride, trans-2-(Trifluoromethyl)cyclopropylamine hydrochloride, 97%, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 5g, 0,5g, 50mg, 100mg, 500mg.
Trans-(1R,2R)-2-(trifluoromethyl)cyclopropan-1-amine;hydrochloride (CAS 1287760-01-3) is a chemical compound with the molecular formula C4H7ClF3N and a molecular weight of 161.55 g/mol. IUPAC name: trans-(1R,2R)-2-(trifluoromethyl)cyclopropan-1-amine;hydrochloride. InChIKey: SOHXDJVKUXKZIJ-SWLXLVAMSA-N.
| Molecular formula | C4H7ClF3N |
|---|---|
| Molecular weight | 161.55 g/mol |
| IUPAC name | trans-(1R,2R)-2-(trifluoromethyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | SOHXDJVKUXKZIJ-SWLXLVAMSA-N |
| SMILES | C1[C@H]([C@@H]1N)C(F)(F)F.Cl |
Computed by PubChem (NCBI)