Products 1258641-12-1
CAS 1258641-12-1 is the registry number for 2-Chloro-N-methyl-N-{(3-(trifluoromethyl)phenyl)methyl}acetamide. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-chloro-N-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]acetamide (CAS 1258641-12-1) is a chemical compound with the molecular formula C11H11ClF3NO and a molecular weight of 265.66 g/mol. IUPAC name: 2-chloro-N-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]acetamide. InChIKey: ARPBDBFJPMUDER-UHFFFAOYSA-N.
| Molecular formula | C11H11ClF3NO |
|---|---|
| Molecular weight | 265.66 g/mol |
| IUPAC name | 2-chloro-N-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]acetamide |
| InChIKey | ARPBDBFJPMUDER-UHFFFAOYSA-N |
| SMILES | CN(CC1=CC(=CC=C1)C(F)(F)F)C(=O)CCl |
Computed by PubChem (NCBI)