CAS 1258651-71-6 is the registry number for 2-(2-Chloropyridin-4-yl)-6-ethyl-3,4-dihydropyrimidin-4-one. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-(2-chloro-4-pyridinyl)-4-ethyl-1H-pyrimidin-6-one (CAS 1258651-71-6) is a chemical compound with the molecular formula C11H10ClN3O and a molecular weight of 235.67 g/mol. IUPAC name: 2-(2-chloro-4-pyridinyl)-4-ethyl-1H-pyrimidin-6-one. InChIKey: SKRMXIZHRLRCHG-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN3O |
|---|---|
| Molecular weight | 235.67 g/mol |
| IUPAC name | 2-(2-chloro-4-pyridinyl)-4-ethyl-1H-pyrimidin-6-one |
| InChIKey | SKRMXIZHRLRCHG-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=O)NC(=N1)C2=CC(=NC=C2)Cl |
Computed by PubChem (NCBI)