CAS 1258652-18-4 appears in our catalog under these names: (1R,2S)-rel-2-(Trifluoromethyl)cyclopropanecarboxylic acid, 98%, (1S,2R)-2-(Trifluoromethyl)cyclopropane-1-carboxylicacid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
Cis-(1R,2S)-2-(trifluoromethyl)cyclopropane-1-carboxylic acid (CAS 1258652-18-4) is a chemical compound with the molecular formula C5H5F3O2 and a molecular weight of 154.09 g/mol. IUPAC name: cis-(1R,2S)-2-(trifluoromethyl)cyclopropane-1-carboxylic acid. InChIKey: GSNLYQDUCHEFFQ-GBXIJSLDSA-N.
| Molecular formula | C5H5F3O2 |
|---|---|
| Molecular weight | 154.09 g/mol |
| IUPAC name | cis-(1R,2S)-2-(trifluoromethyl)cyclopropane-1-carboxylic acid |
| InChIKey | GSNLYQDUCHEFFQ-GBXIJSLDSA-N |
| SMILES | C1[C@H]([C@H]1C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)