CAS 1932455-67-8 appears in our catalog under these names: (1R,2R)-2-(Trifluoromethyl)cyclopropanecarboxylic Acid, 95%, 95%, (1R,2R)-2-(Trifluoromethyl)cyclopropanecarboxylic acid, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g.
Trans-(1R,2R)-2-(trifluoromethyl)cyclopropane-1-carboxylic acid (CAS 1932455-67-8) is a chemical compound with the molecular formula C5H5F3O2 and a molecular weight of 154.09 g/mol. IUPAC name: trans-(1R,2R)-2-(trifluoromethyl)cyclopropane-1-carboxylic acid. InChIKey: GSNLYQDUCHEFFQ-PWNYCUMCSA-N.
| Molecular formula | C5H5F3O2 |
|---|---|
| Molecular weight | 154.09 g/mol |
| IUPAC name | trans-(1R,2R)-2-(trifluoromethyl)cyclopropane-1-carboxylic acid |
| InChIKey | GSNLYQDUCHEFFQ-PWNYCUMCSA-N |
| SMILES | C1[C@H]([C@@H]1C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)