CAS 1258940-00-9 appears in our catalog under these names: (S)-3-Phenylpiperidine hydrochloride, 95%, (S)–3–Phenylpiperidine hydrochloride, (S)-3-Phenylpiperidine hydrochloride, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg, 500mg.
(3S)-3-phenylpiperidine;hydrochloride (CAS 1258940-00-9) is a chemical compound with the molecular formula C11H16ClN and a molecular weight of 197.70 g/mol. IUPAC name: (3S)-3-phenylpiperidine;hydrochloride. InChIKey: OKVMJYYCFLIGFJ-RFVHGSKJSA-N.
| Molecular formula | C11H16ClN |
|---|---|
| Molecular weight | 197.70 g/mol |
| IUPAC name | (3S)-3-phenylpiperidine;hydrochloride |
| InChIKey | OKVMJYYCFLIGFJ-RFVHGSKJSA-N |
| SMILES | C1C[C@H](CNC1)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)