CAS 2250243-14-0 appears in our catalog under these names: (R)-5-Methyl-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride, 95%, (R)–5–METHYL–1,2,3,4–TETRAHYDRONAPHTHALEN–1–AMINE HCL. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 100mg, 1g.
(1R)-5-methyl-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride (CAS 2250243-14-0) is a chemical compound with the molecular formula C11H16ClN and a molecular weight of 197.70 g/mol. IUPAC name: (1R)-5-methyl-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride. InChIKey: TZMYJYRNPJFPHL-RFVHGSKJSA-N.
| Molecular formula | C11H16ClN |
|---|---|
| Molecular weight | 197.70 g/mol |
| IUPAC name | (1R)-5-methyl-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride |
| InChIKey | TZMYJYRNPJFPHL-RFVHGSKJSA-N |
| SMILES | CC1=C2CCC[C@H](C2=CC=C1)N.Cl |
Computed by PubChem (NCBI)