Products 450416-58-7
CAS 450416-58-7 appears in our catalog under these names: (R)-3-Phenylpiperidine hydrochloride, 95%, (R)-3-Phenylpiperidine hydrochloride, 98%, (R)-3-Phenylpiperidine Hydrochloride, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 1g, 10g, 5g, 100mg.
(3R)-3-phenylpiperidine;hydrochloride (CAS 450416-58-7) is a chemical compound with the molecular formula C11H16ClN and a molecular weight of 197.70 g/mol. IUPAC name: (3R)-3-phenylpiperidine;hydrochloride. InChIKey: OKVMJYYCFLIGFJ-MERQFXBCSA-N.
| Molecular formula | C11H16ClN |
|---|---|
| Molecular weight | 197.70 g/mol |
| IUPAC name | (3R)-3-phenylpiperidine;hydrochloride |
| InChIKey | OKVMJYYCFLIGFJ-MERQFXBCSA-N |
| SMILES | C1C[C@@H](CNC1)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)