CAS 125903-76-6 appears in our catalog under these names: 2-[3-(Trifluoromethyl)phenyl]ethanimidamide hydrochloride, 95%, 2-(3-(Trifluoromethyl)phenyl)acetimidamide hydrochloride, 98%, 2-(3-(Trifluoromethyl)phenyl)ethanimidamide hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2-[3-(trifluoromethyl)phenyl]ethanimidamide;hydrochloride (CAS 125903-76-6) is a chemical compound with the molecular formula C9H10ClF3N2 and a molecular weight of 238.64 g/mol. IUPAC name: 2-[3-(trifluoromethyl)phenyl]ethanimidamide;hydrochloride. InChIKey: LUEFQIQZHSTGGN-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF3N2 |
|---|---|
| Molecular weight | 238.64 g/mol |
| IUPAC name | 2-[3-(trifluoromethyl)phenyl]ethanimidamide;hydrochloride |
| InChIKey | LUEFQIQZHSTGGN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)CC(=N)N.Cl |
Computed by PubChem (NCBI)