CAS 741736-98-1 appears in our catalog under these names: 2-(Trifluoromethyl)-5,6,7,8-tetrahydro-1,6-naphthyridine hydrochloride, 95%, 2–(Trifluoromethyl)–5,6,7,8–tetrahydro–1,6–naphthyridine hydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g, 25mg.
2-(trifluoromethyl)-5,6,7,8-tetrahydro-1,6-naphthyridine;hydrochloride (CAS 741736-98-1) is a chemical compound with the molecular formula C9H10ClF3N2 and a molecular weight of 238.64 g/mol. IUPAC name: 2-(trifluoromethyl)-5,6,7,8-tetrahydro-1,6-naphthyridine;hydrochloride. InChIKey: CZBDSVSNEMGVSY-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF3N2 |
|---|---|
| Molecular weight | 238.64 g/mol |
| IUPAC name | 2-(trifluoromethyl)-5,6,7,8-tetrahydro-1,6-naphthyridine;hydrochloride |
| InChIKey | CZBDSVSNEMGVSY-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1N=C(C=C2)C(F)(F)F.Cl |
Computed by PubChem (NCBI)