CAS 2733439-42-2 is the registry number for 4-Methyl-3-(trifluoromethyl)benzimidamide hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-methyl-3-(trifluoromethyl)benzenecarboximidamide;hydrochloride (CAS 2733439-42-2) is a chemical compound with the molecular formula C9H10ClF3N2 and a molecular weight of 238.64 g/mol. IUPAC name: 4-methyl-3-(trifluoromethyl)benzenecarboximidamide;hydrochloride. InChIKey: MQTDGVRIHAJJTP-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF3N2 |
|---|---|
| Molecular weight | 238.64 g/mol |
| IUPAC name | 4-methyl-3-(trifluoromethyl)benzenecarboximidamide;hydrochloride |
| InChIKey | MQTDGVRIHAJJTP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=N)N)C(F)(F)F.Cl |
Computed by PubChem (NCBI)