CAS 125923-59-3 appears in our catalog under these names: Methyl 2,2-difluoro-2-(4-fluorophenyl)acetate, 95-<97%, Methyl 2,2-difluoro-2-(4-fluorophenyl)acetate, 95%. Offered by: Hoffman Fine Chemicals, Chemat Brand. Available pack sizes: 5g, 10g, 25g, on request.
Methyl 2,2-difluoro-2-(4-fluorophenyl)acetate (CAS 125923-59-3) is a chemical compound with the molecular formula C9H7F3O2 and a molecular weight of 204.15 g/mol. IUPAC name: methyl 2,2-difluoro-2-(4-fluorophenyl)acetate. InChIKey: CLQQLXMVYUJEJV-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O2 |
|---|---|
| Molecular weight | 204.15 g/mol |
| IUPAC name | methyl 2,2-difluoro-2-(4-fluorophenyl)acetate |
| InChIKey | CLQQLXMVYUJEJV-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC=C(C=C1)F)(F)F |
Computed by PubChem (NCBI)