Products 1259317-45-7
CAS 1259317-45-7 is the registry number for 2-Methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine (CAS 1259317-45-7) is a chemical compound with the molecular formula C11H17BN2O3 and a molecular weight of 236.08 g/mol. IUPAC name: 2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine. InChIKey: YZKHERUJQVUHGM-UHFFFAOYSA-N.
| Molecular formula | C11H17BN2O3 |
|---|---|
| Molecular weight | 236.08 g/mol |
| IUPAC name | 2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine |
| InChIKey | YZKHERUJQVUHGM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=NC(=NC=C2)OC |
Computed by PubChem (NCBI)