Products 1259394-20-1
CAS 1259394-20-1 is the registry number for 4-Methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine (CAS 1259394-20-1) is a chemical compound with the molecular formula C11H18BN3O2 and a molecular weight of 235.09 g/mol. IUPAC name: 4-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine. InChIKey: WWNNIKQJPMBRJH-UHFFFAOYSA-N.
| Molecular formula | C11H18BN3O2 |
|---|---|
| Molecular weight | 235.09 g/mol |
| IUPAC name | 4-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine |
| InChIKey | WWNNIKQJPMBRJH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC(=N2)N)C |
Computed by PubChem (NCBI)