CAS 2267317-86-0 is the registry number for 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2,3-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2,3-diamine (CAS 2267317-86-0) is a chemical compound with the molecular formula C11H18BN3O2 and a molecular weight of 235.09 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2,3-diamine. InChIKey: CTFFAXJQYHKODV-UHFFFAOYSA-N.
| Molecular formula | C11H18BN3O2 |
|---|---|
| Molecular weight | 235.09 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2,3-diamine |
| InChIKey | CTFFAXJQYHKODV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=NC=C2)N)N |
Computed by PubChem (NCBI)