CAS 1259396-60-5 appears in our catalog under these names: Benzyl ethyl-L-valinate HCl, 98%, Benzyl ethyl–L–valinate hydrochloride, Benzyl Ethyl-L-Valinate Hydrochloride, 98%, 98%, Benzyl ethyl-L-valinate hydrochloride, 99.94%, Benzyl ethyl-L-valinate hydrochloride, 98%. Offered by: AmBeed, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 25mg, 100mg, 50mg, 100 mg, 25 mg, 50 mg, 250 mg.
Benzyl (2S)-2-(ethylamino)-3-methylbutanoate;hydrochloride (CAS 1259396-60-5) is a chemical compound with the molecular formula C14H22ClNO2 and a molecular weight of 271.78 g/mol. IUPAC name: benzyl (2S)-2-(ethylamino)-3-methylbutanoate;hydrochloride. InChIKey: HQXCYDWWDUJWQO-ZOWNYOTGSA-N.
| Molecular formula | C14H22ClNO2 |
|---|---|
| Molecular weight | 271.78 g/mol |
| IUPAC name | benzyl (2S)-2-(ethylamino)-3-methylbutanoate;hydrochloride |
| InChIKey | HQXCYDWWDUJWQO-ZOWNYOTGSA-N |
| SMILES | CCN[C@@H](C(C)C)C(=O)OCC1=CC=CC=C1.Cl |
Computed by PubChem (NCBI)