Products 1259519-59-9
CAS 1259519-59-9 is the registry number for trans 4-Dimethylaminocrotonic Acid-d6 Hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 1mg, 2mg, 5mg, 25mg.
(E)-4-[bis(trideuteriomethyl)amino]but-2-enoic acid;hydrochloride (CAS 1259519-59-9) is a chemical compound with the molecular formula C6H12ClNO2 and a molecular weight of 171.65 g/mol. IUPAC name: (E)-4-[bis(trideuteriomethyl)amino]but-2-enoic acid;hydrochloride. InChIKey: UUHNQHFOIVLAQX-QHNUCIEHSA-N.
| Molecular formula | C6H12ClNO2 |
|---|---|
| Molecular weight | 171.65 g/mol |
| IUPAC name | (E)-4-[bis(trideuteriomethyl)amino]but-2-enoic acid;hydrochloride |
| InChIKey | UUHNQHFOIVLAQX-QHNUCIEHSA-N |
| SMILES | [2H]C([2H])([2H])N(C/C=C/C(=O)O)C([2H])([2H])[2H].Cl |
Computed by PubChem (NCBI)