CAS 31137-95-8 is the registry number for (4R)-4-Methyl-d-proline hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg.
(2R,4R)-4-methylpyrrolidine-2-carboxylic acid;hydrochloride (CAS 31137-95-8) is a chemical compound with the molecular formula C6H12ClNO2 and a molecular weight of 165.62 g/mol. IUPAC name: (2R,4R)-4-methylpyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: VLDINRBTKBFNDD-TYSVMGFPSA-N.
| Molecular formula | C6H12ClNO2 |
|---|---|
| Molecular weight | 165.62 g/mol |
| IUPAC name | (2R,4R)-4-methylpyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | VLDINRBTKBFNDD-TYSVMGFPSA-N |
| SMILES | C[C@@H]1C[C@@H](NC1)C(=O)O.Cl |
Computed by PubChem (NCBI)