CAS 365280-18-8 appears in our catalog under these names: (2S,4R)-4-Methylpyrrolidine-2-carboxylic acid hydrochloride, 95%, trans-4-Methyl-L-proline Hydrochloride, (4R)-4-Methyl-L-proline hydrochloride, 95%, 95%. Offered by: Combi-blocks, TRC, Chemat. Available pack sizes: 250mg, 100mg, 1g.
(2S,4R)-4-methylpyrrolidine-2-carboxylic acid;hydrochloride (CAS 365280-18-8) is a chemical compound with the molecular formula C6H12ClNO2 and a molecular weight of 165.62 g/mol. IUPAC name: (2S,4R)-4-methylpyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: VLDINRBTKBFNDD-JBUOLDKXSA-N.
| Molecular formula | C6H12ClNO2 |
|---|---|
| Molecular weight | 165.62 g/mol |
| IUPAC name | (2S,4R)-4-methylpyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | VLDINRBTKBFNDD-JBUOLDKXSA-N |
| SMILES | C[C@@H]1C[C@H](NC1)C(=O)O.Cl |
Computed by PubChem (NCBI)