Products 1259532-72-3
CAS 1259532-72-3 appears in our catalog under these names: 2-Amino-3-bromo-6-fluorobenzoic Acid, 2-Amino-3-bromo-6-fluorobenzoic acid, 98%, 2-AMINO-3-BROMO-6-FLUOROBENZOIC ACID, 96%, 2-Amino-3-bromo-6-fluorobenzoic acid, 96%, 96%. Offered by: TRC, Biosynth, AmBeed, Fluorochem, Chemat. Available pack sizes: 1g, 100mg, 10g, 5g, 250mg.
2-amino-3-bromo-6-fluorobenzoic acid (CAS 1259532-72-3) is a chemical compound with the molecular formula C7H5BrFNO2 and a molecular weight of 234.02 g/mol. IUPAC name: 2-amino-3-bromo-6-fluorobenzoic acid. InChIKey: HJDCTDZGTGANJF-UHFFFAOYSA-N.
| Molecular formula | C7H5BrFNO2 |
|---|---|
| Molecular weight | 234.02 g/mol |
| IUPAC name | 2-amino-3-bromo-6-fluorobenzoic acid |
| InChIKey | HJDCTDZGTGANJF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)C(=O)O)N)Br |
Computed by PubChem (NCBI)