CAS 1259573-13-1 is the registry number for (S)-6-Bromo-4-chloro-2,3-dihydro-1H-inden-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-6-bromo-4-chloro-2,3-dihydro-1H-inden-1-amine (CAS 1259573-13-1) is a chemical compound with the molecular formula C9H9BrClN and a molecular weight of 246.53 g/mol. IUPAC name: (1S)-6-bromo-4-chloro-2,3-dihydro-1H-inden-1-amine. InChIKey: QNCZPAIGYTYUTD-VIFPVBQESA-N.
| Molecular formula | C9H9BrClN |
|---|---|
| Molecular weight | 246.53 g/mol |
| IUPAC name | (1S)-6-bromo-4-chloro-2,3-dihydro-1H-inden-1-amine |
| InChIKey | QNCZPAIGYTYUTD-VIFPVBQESA-N |
| SMILES | C1CC2=C([C@H]1N)C=C(C=C2Cl)Br |
Computed by PubChem (NCBI)