Products 1522580-66-0
CAS 1522580-66-0 appears in our catalog under these names: 5-Bromo-7-chloro-1,2,3,4-tetrahydroisoquinoline, 95%, 5-Bromo-7-chloro-1,2,3,4-tetrahydroisoquinoline, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g, 10g.
5-bromo-7-chloro-1,2,3,4-tetrahydroisoquinoline (CAS 1522580-66-0) is a chemical compound with the molecular formula C9H9BrClN and a molecular weight of 246.53 g/mol. IUPAC name: 5-bromo-7-chloro-1,2,3,4-tetrahydroisoquinoline. InChIKey: IBNXOISQNWZPPK-UHFFFAOYSA-N.
| Molecular formula | C9H9BrClN |
|---|---|
| Molecular weight | 246.53 g/mol |
| IUPAC name | 5-bromo-7-chloro-1,2,3,4-tetrahydroisoquinoline |
| InChIKey | IBNXOISQNWZPPK-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1C(=CC(=C2)Cl)Br |
Computed by PubChem (NCBI)