CAS 1337694-57-1 is the registry number for 7-Bromo-5-chloro-2,3-dihydro-1H-inden-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-5-chloro-2,3-dihydro-1H-inden-1-amine (CAS 1337694-57-1) is a chemical compound with the molecular formula C9H9BrClN and a molecular weight of 246.53 g/mol. IUPAC name: 7-bromo-5-chloro-2,3-dihydro-1H-inden-1-amine. InChIKey: XNOMNNRESKWHBD-UHFFFAOYSA-N.
| Molecular formula | C9H9BrClN |
|---|---|
| Molecular weight | 246.53 g/mol |
| IUPAC name | 7-bromo-5-chloro-2,3-dihydro-1H-inden-1-amine |
| InChIKey | XNOMNNRESKWHBD-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1N)C(=CC(=C2)Cl)Br |
Computed by PubChem (NCBI)